C25H43NO5 — CID 72792142
(2-acetamido-3-acetyloxy-9-methyloctadeca-4,8-dienyl) acetate (PubChem CID 72792142) has the molecular formula C25H43NO5 and a molecular weight of 437.62 g/mol. Its IUPAC name is (2-acetamido-3-acetyloxy-9-methyloctadeca-4,8-dienyl) acetate.
| Compound Name | (2-acetamido-3-acetyloxy-9-methyloctadeca-4,8-dienyl) acetate |
|---|---|
| PubChem CID | 72792142 |
| Molecular Formula | C25H43NO5 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | (2-acetamido-3-acetyloxy-9-methyloctadeca-4,8-dienyl) acetate |
| SMILES | CCCCCCCCCC(C)=CCCC=CC(OC(C)=O)C(COC(C)=O)NC(C)=O |
| InChI | InChI=1S/C25H43NO5/c1-6-7-8-9-10-11-13-16-20(2)17-14-12-15-18-25(31-23(5)29)24(26-21(3)27)19-30-22(4)28/h15,17-18,24-25H,6-14,16,19H2,1-5H3,(H,26,27) |
| InChIKey | RSJZXCLCBGAFCY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|