C24H32N2O9 — CID 135007306
[(1S,4R)-5-[4-[acetyl-[(2R,5S)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enylamino]-4-acetyloxycyclopent-2-en-1-yl] acetate (PubChem CID 135007306) has the molecular formula C24H32N2O9 and a molecular weight of 492.53 g/mol. Its IUPAC name is [(1S,4R)-5-[4-[acetyl-[(2R,5S)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enylamino]-4-acetyloxycyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4R)-5-[4-[acetyl-[(2R,5S)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enylamino]-4-acetyloxycyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 135007306 |
| Molecular Formula | C24H32N2O9 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [(1S,4R)-5-[4-[acetyl-[(2R,5S)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enylamino]-4-acetyloxycyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](OC(C)=O)C1NCC=CCN(C(C)=O)C1[C@@H](OC(C)=O)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H32N2O9/c1-14(27)26(24-21(34-17(4)30)10-11-22(24)35-18(5)31)13-7-6-12-25-23-19(32-15(2)28)8-9-20(23)33-16(3)29/h6-11,19-25H,12-13H2,1-5H3/t19-,20+,21-,22+,23?,24? |
| InChIKey | JMMATMDSGDXVHI-QVGYUHCVSA-N |
| XLogP | 0.58 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|