C10H16N2O4 — CID 10633096
[(1S,4R,5S)-5-[(2-amino-2-oxoethyl)amino]-4-methoxycyclopent-2-en-1-yl] acetate (PubChem CID 10633096) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is [(1S,4R,5S)-5-[(2-amino-2-oxoethyl)amino]-4-methoxycyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4R,5S)-5-[(2-amino-2-oxoethyl)amino]-4-methoxycyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10633096 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [(1S,4R,5S)-5-[(2-amino-2-oxoethyl)amino]-4-methoxycyclopent-2-en-1-yl] acetate |
| SMILES | CO[C@@H]1C=C[C@H](OC(C)=O)[C@H]1NCC(N)=O |
| InChI | InChI=1S/C10H16N2O4/c1-6(13)16-8-4-3-7(15-2)10(8)12-5-9(11)14/h3-4,7-8,10,12H,5H2,1-2H3,(H2,11,14)/t7-,8+,10+/m1/s1 |
| InChIKey | YGTOKBFETYUSGL-WEDXCCLWSA-N |
| XLogP | -1.05 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|