C9H16N2O3 — CID 10798093
2-[[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]amino]acetamide (PubChem CID 10798093) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]amino]acetamide.
| Compound Name | 2-[[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]amino]acetamide |
|---|---|
| PubChem CID | 10798093 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-[[(2R,5S)-2,5-dimethoxycyclopent-3-en-1-yl]amino]acetamide |
| SMILES | CO[C@H]1C=C[C@@H](OC)C1NCC(N)=O |
| InChI | InChI=1S/C9H16N2O3/c1-13-6-3-4-7(14-2)9(6)11-5-8(10)12/h3-4,6-7,9,11H,5H2,1-2H3,(H2,10,12)/t6-,7+,9? |
| InChIKey | YKRYCESHLLJGKN-AVSFMBPQSA-N |
| XLogP | -0.97 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|