C13H23NO4 — CID 144618305
[(Z,2S)-5-[[(2R,3R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 144618305) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is [(Z,2S)-5-[[(2R,3R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(Z,2S)-5-[[(2R,3R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 144618305 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [(Z,2S)-5-[[(2R,3R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CC[C@@H](NC(=O)/C=C\[C@H](C)OC(C)=O)[C@@H](C)OC |
| InChI | InChI=1S/C13H23NO4/c1-6-12(10(3)17-5)14-13(16)8-7-9(2)18-11(4)15/h7-10,12H,6H2,1-5H3,(H,14,16)/b8-7-/t9-,10+,12+/m0/s1 |
| InChIKey | KOORTFMNTFLJND-QKFVACRESA-N |
| XLogP | 1.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|