C13H23NO4 — CID 123939513
[(2S,3R)-1-hydroxy-2-(propanoylamino)oct-4-en-3-yl] acetate (PubChem CID 123939513) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is [(2S,3R)-1-hydroxy-2-(propanoylamino)oct-4-en-3-yl] acetate.
| Compound Name | [(2S,3R)-1-hydroxy-2-(propanoylamino)oct-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 123939513 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [(2S,3R)-1-hydroxy-2-(propanoylamino)oct-4-en-3-yl] acetate |
| SMILES | CCCC=C[C@@H](OC(C)=O)[C@H](CO)NC(=O)CC |
| InChI | InChI=1S/C13H23NO4/c1-4-6-7-8-12(18-10(3)16)11(9-15)14-13(17)5-2/h7-8,11-12,15H,4-6,9H2,1-3H3,(H,14,17)/t11-,12+/m0/s1 |
| InChIKey | MJNGNDYQBGOTEA-NWDGAFQWSA-N |
| XLogP | 1.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|