C10H17NO4 — CID 59889487
[(E,2S,3R)-2-acetamido-1-hydroxyhex-4-en-3-yl] acetate (PubChem CID 59889487) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is [(E,2S,3R)-2-acetamido-1-hydroxyhex-4-en-3-yl] acetate.
| Compound Name | [(E,2S,3R)-2-acetamido-1-hydroxyhex-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 59889487 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | [(E,2S,3R)-2-acetamido-1-hydroxyhex-4-en-3-yl] acetate |
| SMILES | C/C=C/[C@@H](OC(C)=O)[C@H](CO)NC(C)=O |
| InChI | InChI=1S/C10H17NO4/c1-4-5-10(15-8(3)14)9(6-12)11-7(2)13/h4-5,9-10,12H,6H2,1-3H3,(H,11,13)/b5-4+/t9-,10+/m0/s1 |
| InChIKey | OUMGVJBFUVHEQE-OCIBVNFRSA-N |
| XLogP | -0.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|