C16H29NO5Si — CID 10665089
[(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] ethyl carbonate (PubChem CID 10665089) has the molecular formula C16H29NO5Si and a molecular weight of 343.50 g/mol. Its IUPAC name is [(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] ethyl carbonate.
| Compound Name | [(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] ethyl carbonate |
|---|---|
| PubChem CID | 10665089 |
| Molecular Formula | C16H29NO5Si |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(1S,4S,5R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C16H29NO5Si/c1-8-20-15(19)21-12-9-10-13(14(12)17-11(2)18)22-23(6,7)16(3,4)5/h9-10,12-14H,8H2,1-7H3,(H,17,18)/t12-,13-,14+/m0/s1 |
| InChIKey | GMGUUVCWSZGXAH-MELADBBJSA-N |
| XLogP | 2.99 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|