C15H29NO4Si — CID 11012516
methyl (Z,2R)-2-acetamido-6-[tert-butyl(dimethyl)silyl]oxyhex-4-enoate (PubChem CID 11012516) has the molecular formula C15H29NO4Si and a molecular weight of 315.49 g/mol. Its IUPAC name is methyl (Z,2R)-2-acetamido-6-[tert-butyl(dimethyl)silyl]oxyhex-4-enoate.
| Compound Name | methyl (Z,2R)-2-acetamido-6-[tert-butyl(dimethyl)silyl]oxyhex-4-enoate |
|---|---|
| PubChem CID | 11012516 |
| Molecular Formula | C15H29NO4Si |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | methyl (Z,2R)-2-acetamido-6-[tert-butyl(dimethyl)silyl]oxyhex-4-enoate |
| SMILES | COC(=O)[C@@H](C/C=C\CO[Si](C)(C)C(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C15H29NO4Si/c1-12(17)16-13(14(18)19-5)10-8-9-11-20-21(6,7)15(2,3)4/h8-9,13H,10-11H2,1-7H3,(H,16,17)/b9-8-/t13-/m1/s1 |
| InChIKey | LXZYJRGOYXODQZ-LJTDUEICSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|