C14H20F3NO6 — CID 11302697
1-O-tert-butyl 2-O,3-O-diethyl (2R,3S)-2-(trifluoromethyl)aziridine-1,2,3-tricarboxylate (PubChem CID 11302697) has the molecular formula C14H20F3NO6 and a molecular weight of 355.31 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,3-O-diethyl (2R,3S)-2-(trifluoromethyl)aziridine-1,2,3-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,3-O-diethyl (2R,3S)-2-(trifluoromethyl)aziridine-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 11302697 |
| Molecular Formula | C14H20F3NO6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-O-tert-butyl 2-O,3-O-diethyl (2R,3S)-2-(trifluoromethyl)aziridine-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1N(C(=O)OC(C)(C)C)[C@]1(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO6/c1-6-22-9(19)8-13(14(15,16)17,10(20)23-7-2)18(8)11(21)24-12(3,4)5/h8H,6-7H2,1-5H3/t8-,13-,18?/m1/s1 |
| InChIKey | OGXHVPYADYTXHH-KQVPSDPCSA-N |
| XLogP | 2.03 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|