C12H19NO7 — CID 11426268
2-O-tert-butyl 3-O,3-O'-diethyl oxaziridine-2,3,3-tricarboxylate (PubChem CID 11426268) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O,3-O'-diethyl oxaziridine-2,3,3-tricarboxylate.
| Compound Name | 2-O-tert-butyl 3-O,3-O'-diethyl oxaziridine-2,3,3-tricarboxylate |
|---|---|
| PubChem CID | 11426268 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-O-tert-butyl 3-O,3-O'-diethyl oxaziridine-2,3,3-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)ON1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19NO7/c1-6-17-8(14)12(9(15)18-7-2)13(20-12)10(16)19-11(3,4)5/h6-7H2,1-5H3 |
| InChIKey | IPVOKKLZOPXJRZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 94.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|