C19H18FN3O2S — CID 113027064
N-[5-[(2-fluorophenyl)methylamino]-2-pyridinyl]-3-methylbenzenesulfonamide (PubChem CID 113027064) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylamino]-2-pyridinyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylamino]-2-pyridinyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113027064 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylamino]-2-pyridinyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(NCc3ccccc3F)cn2)c1 |
| InChI | InChI=1S/C19H18FN3O2S/c1-14-5-4-7-17(11-14)26(24,25)23-19-10-9-16(13-22-19)21-12-15-6-2-3-8-18(15)20/h2-11,13,21H,12H2,1H3,(H,22,23) |
| InChIKey | FITULFOJUOPMOK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |