C19H20N4O2S — CID 113028583
N-[5-[methyl(2-pyridin-4-ylethyl)amino]-2-pyridinyl]benzenesulfonamide (PubChem CID 113028583) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[5-[methyl(2-pyridin-4-ylethyl)amino]-2-pyridinyl]benzenesulfonamide.
| Compound Name | N-[5-[methyl(2-pyridin-4-ylethyl)amino]-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113028583 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[5-[methyl(2-pyridin-4-ylethyl)amino]-2-pyridinyl]benzenesulfonamide |
| SMILES | CN(CCc1ccncc1)c1ccc(NS(=O)(=O)c2ccccc2)nc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-23(14-11-16-9-12-20-13-10-16)17-7-8-19(21-15-17)22-26(24,25)18-5-3-2-4-6-18/h2-10,12-13,15H,11,14H2,1H3,(H,21,22) |
| InChIKey | WXHZIMYDSWOBEY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |