C20H21N3O2S — CID 112983750
N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzenesulfonamide (PubChem CID 112983750) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112983750 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[4-[methyl(2-pyridin-4-ylethyl)amino]phenyl]benzenesulfonamide |
| SMILES | CN(CCc1ccncc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-23(16-13-17-11-14-21-15-12-17)19-9-7-18(8-10-19)22-26(24,25)20-5-3-2-4-6-20/h2-12,14-15,22H,13,16H2,1H3 |
| InChIKey | JPSDSEVXLRIQIS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|