C15H21Cl2NO5 — CID 11303065
(1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R,2S,3S)-3-chloro-2-hydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 11303065) has the molecular formula C15H21Cl2NO5 and a molecular weight of 366.24 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R,2S,3S)-3-chloro-2-hydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R,2S,3S)-3-chloro-2-hydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 11303065 |
| Molecular Formula | C15H21Cl2NO5 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R,2S,3S)-3-chloro-2-hydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C[C@@]12OC(=O)[C@]1([C@@H](O)[C@H]1CCC[C@H](Cl)[C@H]1O)NC(=O)[C@@H]2CCCl |
| InChI | InChI=1S/C15H21Cl2NO5/c1-14-8(5-6-16)12(21)18-15(14,13(22)23-14)11(20)7-3-2-4-9(17)10(7)19/h7-11,19-20H,2-6H2,1H3,(H,18,21)/t7-,8-,9-,10-,11-,14-,15-/m0/s1 |
| InChIKey | NQHGLNAPMWOUKN-RWOBCWRPSA-N |
| XLogP | 0.54 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|