C16H21N3O2S — CID 113032862
N-[5-(2,6-diethylanilino)-2-pyridinyl]methanesulfonamide (PubChem CID 113032862) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[5-(2,6-diethylanilino)-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[5-(2,6-diethylanilino)-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 113032862 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[5-(2,6-diethylanilino)-2-pyridinyl]methanesulfonamide |
| SMILES | CCc1cccc(CC)c1Nc1ccc(NS(C)(=O)=O)nc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-4-12-7-6-8-13(5-2)16(12)18-14-9-10-15(17-11-14)19-22(3,20)21/h6-11,18H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | HRVUIZAVJGQFNS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |