C25H37NO2 — CID 11303636
(1S)-1-[(2S,4aS,7R,8aR)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylbut-3-en-1-ol (PubChem CID 11303636) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (1S)-1-[(2S,4aS,7R,8aR)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylbut-3-en-1-ol.
| Compound Name | (1S)-1-[(2S,4aS,7R,8aR)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 11303636 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (1S)-1-[(2S,4aS,7R,8aR)-3-[(E)-but-2-enyl]-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylbut-3-en-1-ol |
| SMILES | C=CC[C@](O)(c1ccccc1)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1C/C=C/C |
| InChI | InChI=1S/C25H37NO2/c1-6-8-17-26-23(25(27,16-7-2)20-12-10-9-11-13-20)28-22-18-19(3)14-15-21(22)24(26,4)5/h6-13,19,21-23,27H,2,14-18H2,1,3-5H3/b8-6+/t19-,21-,22-,23+,25+/m1/s1 |
| InChIKey | LCTHKFDUZIQVPN-WNWZIICSSA-N |
| XLogP | 5.27 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|