C19H15ClN4O2S — CID 113037337
4-chloro-N-[5-(4-cyanoanilino)-2-pyridinyl]-3-methylbenzenesulfonamide (PubChem CID 113037337) has the molecular formula C19H15ClN4O2S and a molecular weight of 398.88 g/mol. Its IUPAC name is 4-chloro-N-[5-(4-cyanoanilino)-2-pyridinyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[5-(4-cyanoanilino)-2-pyridinyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113037337 |
| Molecular Formula | C19H15ClN4O2S |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-chloro-N-[5-(4-cyanoanilino)-2-pyridinyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(Nc3ccc(C#N)cc3)cn2)ccc1Cl |
| InChI | InChI=1S/C19H15ClN4O2S/c1-13-10-17(7-8-18(13)20)27(25,26)24-19-9-6-16(12-22-19)23-15-4-2-14(11-21)3-5-15/h2-10,12,23H,1H3,(H,22,24) |
| InChIKey | RQRQVVZBSHCFLQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |