C23H24N4O — CID 113038844
N-[6-(cyclopentylamino)pyridazin-3-yl]-2,2-diphenylacetamide (PubChem CID 113038844) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[6-(cyclopentylamino)pyridazin-3-yl]-2,2-diphenylacetamide.
| Compound Name | N-[6-(cyclopentylamino)pyridazin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 113038844 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[6-(cyclopentylamino)pyridazin-3-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(NC2CCCC2)nn1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N4O/c28-23(22(17-9-3-1-4-10-17)18-11-5-2-6-12-18)25-21-16-15-20(26-27-21)24-19-13-7-8-14-19/h1-6,9-12,15-16,19,22H,7-8,13-14H2,(H,24,26)(H,25,27,28) |
| InChIKey | WZXWRIPXPFTBKY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |