C16H13BrN4O2 — CID 113040647
2-bromo-N-[6-(furan-2-ylmethylamino)pyridazin-3-yl]benzamide (PubChem CID 113040647) has the molecular formula C16H13BrN4O2 and a molecular weight of 373.21 g/mol. Its IUPAC name is 2-bromo-N-[6-(furan-2-ylmethylamino)pyridazin-3-yl]benzamide.
| Compound Name | 2-bromo-N-[6-(furan-2-ylmethylamino)pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 113040647 |
| Molecular Formula | C16H13BrN4O2 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-bromo-N-[6-(furan-2-ylmethylamino)pyridazin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(NCc2ccco2)nn1)c1ccccc1Br |
| InChI | InChI=1S/C16H13BrN4O2/c17-13-6-2-1-5-12(13)16(22)19-15-8-7-14(20-21-15)18-10-11-4-3-9-23-11/h1-9H,10H2,(H,18,20)(H,19,21,22) |
| InChIKey | BZTYHXDVTKMDDR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |