C16H15N5O2 — CID 113040691
1-[6-(furan-2-ylmethylamino)pyridazin-3-yl]-3-phenylurea (PubChem CID 113040691) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-[6-(furan-2-ylmethylamino)pyridazin-3-yl]-3-phenylurea.
| Compound Name | 1-[6-(furan-2-ylmethylamino)pyridazin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 113040691 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-[6-(furan-2-ylmethylamino)pyridazin-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(NCc2ccco2)nn1 |
| InChI | InChI=1S/C16H15N5O2/c22-16(18-12-5-2-1-3-6-12)19-15-9-8-14(20-21-15)17-11-13-7-4-10-23-13/h1-10H,11H2,(H,17,20)(H2,18,19,21,22) |
| InChIKey | MYJJOTUEOIKDRP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |