C21H22N4O2 — CID 113041686
N-[6-[(2-methoxyphenyl)methylamino]pyridazin-3-yl]-3,4-dimethylbenzamide (PubChem CID 113041686) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[6-[(2-methoxyphenyl)methylamino]pyridazin-3-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[6-[(2-methoxyphenyl)methylamino]pyridazin-3-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 113041686 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[6-[(2-methoxyphenyl)methylamino]pyridazin-3-yl]-3,4-dimethylbenzamide |
| SMILES | COc1ccccc1CNc1ccc(NC(=O)c2ccc(C)c(C)c2)nn1 |
| InChI | InChI=1S/C21H22N4O2/c1-14-8-9-16(12-15(14)2)21(26)23-20-11-10-19(24-25-20)22-13-17-6-4-5-7-18(17)27-3/h4-12H,13H2,1-3H3,(H,22,24)(H,23,25,26) |
| InChIKey | SIWPXKDPQXRTGS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |