C21H21FN4O — CID 113042585
N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,4-dimethylbenzamide (PubChem CID 113042585) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 113042585 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(NCCc3ccc(F)cc3)nn2)cc1C |
| InChI | InChI=1S/C21H21FN4O/c1-14-3-6-17(13-15(14)2)21(27)24-20-10-9-19(25-26-20)23-12-11-16-4-7-18(22)8-5-16/h3-10,13H,11-12H2,1-2H3,(H,23,25)(H,24,26,27) |
| InChIKey | MUGNKZWDAKEQGM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |