C21H21FN4O3 — CID 113042583
N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,5-dimethoxybenzamide (PubChem CID 113042583) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 113042583 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(NCCc3ccc(F)cc3)nn2)c1 |
| InChI | InChI=1S/C21H21FN4O3/c1-28-17-11-15(12-18(13-17)29-2)21(27)24-20-8-7-19(25-26-20)23-10-9-14-3-5-16(22)6-4-14/h3-8,11-13H,9-10H2,1-2H3,(H,23,25)(H,24,26,27) |
| InChIKey | TUEDYKIYSNDRRR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |