C19H26N6O2 — CID 113043694
1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-propan-2-ylurea (PubChem CID 113043694) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-propan-2-ylurea.
| Compound Name | 1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 113043694 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl]-3-propan-2-ylurea |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)NC(C)C)nn2)CC1 |
| InChI | InChI=1S/C19H26N6O2/c1-14(2)20-19(26)21-17-8-9-18(23-22-17)25-12-10-24(11-13-25)15-6-4-5-7-16(15)27-3/h4-9,14H,10-13H2,1-3H3,(H2,20,21,22,26) |
| InChIKey | DNFBGTCAYZQXCK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |