About N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide
N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide (PubChem CID 113043710) has the molecular formula C21H23N5OS
and a molecular weight of 393.52 g/mol. Its IUPAC name is N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide |
| PubChem CID | 113043710 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(N2CCN(c3ccc(NC(=O)c4cccs4)nn3)CC2)c1C |
| InChI | InChI=1S/C21H23N5OS/c1-15-5-3-6-17(16(15)2)25-10-12-26(13-11-25)20-9-8-19(23-24-20)22-21(27)18-7-4-14-28-18/h3-9,14H,10-13H2,1-2H3,(H,22,23,27) |
| InChIKey | OXROLVHSVBTECG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide?
The IUPAC name of N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide (CID 113043710) is N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide.
What is the SMILES notation for N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide?
The canonical SMILES for N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide is Cc1cccc(N2CCN(c3ccc(NC(=O)c4cccs4)nn3)CC2)c1C.
What is the InChIKey of N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide?
The InChIKey is OXROLVHSVBTECG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5OS/c1-15-5-3-6-17(16(15)2)25-10-12-26(13-11-25)20-9-8-19(23-24-20)22-21(27)18-7-4-14-28-18/h3-9,14H,10-13H2,1-2H3,(H,22,23,27).
What are the key properties of N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide?
N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide has a molecular weight of 393.52 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyridazin-3-yl]thiophene-2-carboxamide is sourced from PubChem (CID 113043710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).