C15H18N4O4 — CID 113044195
methyl N-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]carbamate (PubChem CID 113044195) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl N-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]carbamate.
| Compound Name | methyl N-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113044195 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | methyl N-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]carbamate |
| SMILES | COC(=O)Nc1ccc(NCCOc2ccc(OC)cc2)nn1 |
| InChI | InChI=1S/C15H18N4O4/c1-21-11-3-5-12(6-4-11)23-10-9-16-13-7-8-14(19-18-13)17-15(20)22-2/h3-8H,9-10H2,1-2H3,(H,16,18)(H,17,19,20) |
| InChIKey | HYAWVWRMABHNSU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|