C17H23N5O3 — CID 113044200
1-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]-3-propan-2-ylurea (PubChem CID 113044200) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]-3-propan-2-ylurea.
| Compound Name | 1-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 113044200 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-[6-[2-(4-methoxyphenoxy)ethylamino]pyridazin-3-yl]-3-propan-2-ylurea |
| SMILES | COc1ccc(OCCNc2ccc(NC(=O)NC(C)C)nn2)cc1 |
| InChI | InChI=1S/C17H23N5O3/c1-12(2)19-17(23)20-16-9-8-15(21-22-16)18-10-11-25-14-6-4-13(24-3)5-7-14/h4-9,12H,10-11H2,1-3H3,(H,18,21)(H2,19,20,22,23) |
| InChIKey | NKTPEHFKSIWJSE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|