C15H19N5O2 — CID 113048339
1-[6-(4-methoxyanilino)pyridazin-3-yl]-3-propan-2-ylurea (PubChem CID 113048339) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[6-(4-methoxyanilino)pyridazin-3-yl]-3-propan-2-ylurea.
| Compound Name | 1-[6-(4-methoxyanilino)pyridazin-3-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 113048339 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[6-(4-methoxyanilino)pyridazin-3-yl]-3-propan-2-ylurea |
| SMILES | COc1ccc(Nc2ccc(NC(=O)NC(C)C)nn2)cc1 |
| InChI | InChI=1S/C15H19N5O2/c1-10(2)16-15(21)18-14-9-8-13(19-20-14)17-11-4-6-12(22-3)7-5-11/h4-10H,1-3H3,(H,17,19)(H2,16,18,20,21) |
| InChIKey | DEDPYSUBBDRWRS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |