C26H41N3O — CID 11304464
4-[3-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]morpholine (PubChem CID 11304464) has the molecular formula C26H41N3O and a molecular weight of 411.63 g/mol. Its IUPAC name is 4-[3-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]morpholine.
| Compound Name | 4-[3-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 11304464 |
| Molecular Formula | C26H41N3O |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | 4-[3-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]morpholine |
| SMILES | CC(C)CN1CCN(c2ccc(N3CCOCC3)cc2C2=CCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C26H41N3O/c1-21(2)20-27-11-13-29(14-12-27)25-6-5-23(28-15-17-30-18-16-28)19-24(25)22-7-9-26(3,4)10-8-22/h5-7,19,21H,8-18,20H2,1-4H3 |
| InChIKey | RFLMYCYZHTZYRV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|