C30H46ClN3O2 — CID 23141772
4-[4-[4-(oxan-4-ylmethyl)piperazin-1-yl]-3-spiro[4.5]dec-8-en-8-ylphenyl]morpholine;hydrochloride (PubChem CID 23141772) has the molecular formula C30H46ClN3O2 and a molecular weight of 516.17 g/mol. Its IUPAC name is 4-[4-[4-(oxan-4-ylmethyl)piperazin-1-yl]-3-spiro[4.5]dec-8-en-8-ylphenyl]morpholine;hydrochloride.
| Compound Name | 4-[4-[4-(oxan-4-ylmethyl)piperazin-1-yl]-3-spiro[4.5]dec-8-en-8-ylphenyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 23141772 |
| Molecular Formula | C30H46ClN3O2 |
| Molecular Weight | 516.17 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | 4-[4-[4-(oxan-4-ylmethyl)piperazin-1-yl]-3-spiro[4.5]dec-8-en-8-ylphenyl]morpholine;hydrochloride |
| SMILES | C1=C(c2cc(N3CCOCC3)ccc2N2CCN(CC3CCOCC3)CC2)CCC2(C1)CCCC2.Cl |
| InChI | InChI=1S/C30H45N3O2.ClH/c1-2-10-30(9-1)11-5-26(6-12-30)28-23-27(32-17-21-35-22-18-32)3-4-29(28)33-15-13-31(14-16-33)24-25-7-19-34-20-8-25;/h3-5,23,25H,1-2,6-22,24H2;1H |
| InChIKey | OZOKTUGRQSCZAM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.17 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|