C28H45N3O — CID 23141870
4-[4-[4-(cyclopropylmethyl)piperazin-1-yl]-3-(3,3,5,5-tetramethylcyclohexyl)phenyl]morpholine (PubChem CID 23141870) has the molecular formula C28H45N3O and a molecular weight of 439.69 g/mol. Its IUPAC name is 4-[4-[4-(cyclopropylmethyl)piperazin-1-yl]-3-(3,3,5,5-tetramethylcyclohexyl)phenyl]morpholine.
| Compound Name | 4-[4-[4-(cyclopropylmethyl)piperazin-1-yl]-3-(3,3,5,5-tetramethylcyclohexyl)phenyl]morpholine |
|---|---|
| PubChem CID | 23141870 |
| Molecular Formula | C28H45N3O |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.36 |
| IUPAC Name | 4-[4-[4-(cyclopropylmethyl)piperazin-1-yl]-3-(3,3,5,5-tetramethylcyclohexyl)phenyl]morpholine |
| SMILES | CC1(C)CC(c2cc(N3CCOCC3)ccc2N2CCN(CC3CC3)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C28H45N3O/c1-27(2)18-23(19-28(3,4)21-27)25-17-24(30-13-15-32-16-14-30)7-8-26(25)31-11-9-29(10-12-31)20-22-5-6-22/h7-8,17,22-23H,5-6,9-16,18-21H2,1-4H3 |
| InChIKey | PXPYOICWJSBYLH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|