C28H46N2O3 — CID 23142016
1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-(oxan-4-ylmethyl)piperazine (PubChem CID 23142016) has the molecular formula C28H46N2O3 and a molecular weight of 458.69 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-(oxan-4-ylmethyl)piperazine.
| Compound Name | 1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-(oxan-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 23142016 |
| Molecular Formula | C28H46N2O3 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.35 |
| IUPAC Name | 1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-(oxan-4-ylmethyl)piperazine |
| SMILES | COc1cc(C2CC(C)(C)CC(C)(C)C2)c(N2CCN(CC3CCOCC3)CC2)cc1OC |
| InChI | InChI=1S/C28H46N2O3/c1-27(2)17-22(18-28(3,4)20-27)23-15-25(31-5)26(32-6)16-24(23)30-11-9-29(10-12-30)19-21-7-13-33-14-8-21/h15-16,21-22H,7-14,17-20H2,1-6H3 |
| InChIKey | YXKBECKCZKFRBR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|