C30H49N3O — CID 69217149
1-(cyclopropylmethyl)-4-[4-[(3R)-3-ethoxypyrrolidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine (PubChem CID 69217149) has the molecular formula C30H49N3O and a molecular weight of 467.74 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[4-[(3R)-3-ethoxypyrrolidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine.
| Compound Name | 1-(cyclopropylmethyl)-4-[4-[(3R)-3-ethoxypyrrolidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine |
|---|---|
| PubChem CID | 69217149 |
| Molecular Formula | C30H49N3O |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.39 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[4-[(3R)-3-ethoxypyrrolidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine |
| SMILES | CCO[C@@H]1CCN(c2ccc(N3CCN(CC4CC4)CC3)c(C3CC(C)(C)CC(C)(C)C3)c2)C1 |
| InChI | InChI=1S/C30H49N3O/c1-6-34-26-11-12-33(21-26)25-9-10-28(32-15-13-31(14-16-32)20-23-7-8-23)27(17-25)24-18-29(2,3)22-30(4,5)19-24/h9-10,17,23-24,26H,6-8,11-16,18-22H2,1-5H3/t26-/m1/s1 |
| InChIKey | MQBLIFVKEKZGKO-AREMUKBSSA-N |
| XLogP | 6.15 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|