C29H50ClN3O — CID 23142615
1-[4-(3-ethoxypyrrolidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-propylpiperazine;hydrochloride (PubChem CID 23142615) has the molecular formula C29H50ClN3O and a molecular weight of 492.19 g/mol. Its IUPAC name is 1-[4-(3-ethoxypyrrolidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-propylpiperazine;hydrochloride.
| Compound Name | 1-[4-(3-ethoxypyrrolidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-propylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 23142615 |
| Molecular Formula | C29H50ClN3O |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | 1-[4-(3-ethoxypyrrolidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-propylpiperazine;hydrochloride |
| SMILES | CCCN1CCN(c2ccc(N3CCC(OCC)C3)cc2C2CC(C)(C)CC(C)(C)C2)CC1.Cl |
| InChI | InChI=1S/C29H49N3O.ClH/c1-7-12-30-14-16-31(17-15-30)27-10-9-24(32-13-11-25(21-32)33-8-2)18-26(27)23-19-28(3,4)22-29(5,6)20-23;/h9-10,18,23,25H,7-8,11-17,19-22H2,1-6H3;1H |
| InChIKey | YRVLSHLXWNECLN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|