C31H53N3O — CID 58767702
1-butyl-4-[4-[4-(methoxymethyl)piperidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine (PubChem CID 58767702) has the molecular formula C31H53N3O and a molecular weight of 483.79 g/mol. Its IUPAC name is 1-butyl-4-[4-[4-(methoxymethyl)piperidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine.
| Compound Name | 1-butyl-4-[4-[4-(methoxymethyl)piperidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine |
|---|---|
| PubChem CID | 58767702 |
| Molecular Formula | C31H53N3O |
| Molecular Weight | 483.79 g/mol |
| Exact Mass | 483.42 |
| IUPAC Name | 1-butyl-4-[4-[4-(methoxymethyl)piperidin-1-yl]-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine |
| SMILES | CCCCN1CCN(c2ccc(N3CCC(COC)CC3)cc2C2CC(C)(C)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C31H53N3O/c1-7-8-13-32-16-18-34(19-17-32)29-10-9-27(33-14-11-25(12-15-33)23-35-6)20-28(29)26-21-30(2,3)24-31(4,5)22-26/h9-10,20,25-26H,7-8,11-19,21-24H2,1-6H3 |
| InChIKey | MAQJEIQVHPGLKX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.79 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|