C26H44ClN3 — CID 23142251
1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-pyrrolidin-1-ylphenyl]piperazine;hydrochloride (PubChem CID 23142251) has the molecular formula C26H44ClN3 and a molecular weight of 434.11 g/mol. Its IUPAC name is 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-pyrrolidin-1-ylphenyl]piperazine;hydrochloride.
| Compound Name | 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-pyrrolidin-1-ylphenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 23142251 |
| Molecular Formula | C26H44ClN3 |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-pyrrolidin-1-ylphenyl]piperazine;hydrochloride |
| SMILES | CCCCN1CCN(c2ccc(N3CCCC3)cc2C2CCC(C)(C)CC2)CC1.Cl |
| InChI | InChI=1S/C26H43N3.ClH/c1-4-5-14-27-17-19-29(20-18-27)25-9-8-23(28-15-6-7-16-28)21-24(25)22-10-12-26(2,3)13-11-22;/h8-9,21-22H,4-7,10-20H2,1-3H3;1H |
| InChIKey | PNBRWZSONIOCRC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|