C31H55N3O — CID 143370096
1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2R)-2-methylpyrrolidin-1-yl]phenyl]piperazine;methoxymethane (PubChem CID 143370096) has the molecular formula C31H55N3O and a molecular weight of 485.80 g/mol. Its IUPAC name is 1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2R)-2-methylpyrrolidin-1-yl]phenyl]piperazine;methoxymethane.
| Compound Name | 1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2R)-2-methylpyrrolidin-1-yl]phenyl]piperazine;methoxymethane |
|---|---|
| PubChem CID | 143370096 |
| Molecular Formula | C31H55N3O |
| Molecular Weight | 485.80 g/mol |
| Exact Mass | 485.43 |
| IUPAC Name | 1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2R)-2-methylpyrrolidin-1-yl]phenyl]piperazine;methoxymethane |
| SMILES | CCCCN1CCN(c2ccc(N3CCC[C@H]3C)cc2C2CCC(CC)(CC)CC2)CC1.COC |
| InChI | InChI=1S/C29H49N3.C2H6O/c1-5-8-17-30-19-21-31(22-20-30)28-12-11-26(32-18-9-10-24(32)4)23-27(28)25-13-15-29(6-2,7-3)16-14-25;1-3-2/h11-12,23-25H,5-10,13-22H2,1-4H3;1-2H3/t24-;/m1./s1 |
| InChIKey | YVWZEFZLFRIDKQ-GJFSDDNBSA-N |
| XLogP | 7.32 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.80 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|