C28H47N3O — CID 23141587
4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]morpholine (PubChem CID 23141587) has the molecular formula C28H47N3O and a molecular weight of 441.70 g/mol. Its IUPAC name is 4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]morpholine.
| Compound Name | 4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]morpholine |
|---|---|
| PubChem CID | 23141587 |
| Molecular Formula | C28H47N3O |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 441.37 |
| IUPAC Name | 4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]morpholine |
| SMILES | CCCCN1CCN(c2ccc(N3CCOCC3)cc2C2CCC(CC)(CC)CC2)CC1 |
| InChI | InChI=1S/C28H47N3O/c1-4-7-14-29-15-17-31(18-16-29)27-9-8-25(30-19-21-32-22-20-30)23-26(27)24-10-12-28(5-2,6-3)13-11-24/h8-9,23-24H,4-7,10-22H2,1-3H3 |
| InChIKey | WEUPNXNFKPRPCT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|