C28H45N3O — CID 69220213
4-[4-(4-butylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]-2,6-dimethylmorpholine (PubChem CID 69220213) has the molecular formula C28H45N3O and a molecular weight of 439.69 g/mol. Its IUPAC name is 4-[4-(4-butylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[4-(4-butylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 69220213 |
| Molecular Formula | C28H45N3O |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.36 |
| IUPAC Name | 4-[4-(4-butylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]-2,6-dimethylmorpholine |
| SMILES | CCCCN1CCN(c2ccc(N3CC(C)OC(C)C3)cc2C2CCC3(CC2)CC3)CC1 |
| InChI | InChI=1S/C28H45N3O/c1-4-5-14-29-15-17-30(18-16-29)27-7-6-25(31-20-22(2)32-23(3)21-31)19-26(27)24-8-10-28(11-9-24)12-13-28/h6-7,19,22-24H,4-5,8-18,20-21H2,1-3H3 |
| InChIKey | LXFADUBDRGUERO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|