C27H44ClN3O — CID 23142152
2,6-dimethyl-4-[4-(4-propylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]morpholine;hydrochloride (PubChem CID 23142152) has the molecular formula C27H44ClN3O and a molecular weight of 462.12 g/mol. Its IUPAC name is 2,6-dimethyl-4-[4-(4-propylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]morpholine;hydrochloride.
| Compound Name | 2,6-dimethyl-4-[4-(4-propylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 23142152 |
| Molecular Formula | C27H44ClN3O |
| Molecular Weight | 462.12 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | 2,6-dimethyl-4-[4-(4-propylpiperazin-1-yl)-3-spiro[2.5]octan-6-ylphenyl]morpholine;hydrochloride |
| SMILES | CCCN1CCN(c2ccc(N3CC(C)OC(C)C3)cc2C2CCC3(CC2)CC3)CC1.Cl |
| InChI | InChI=1S/C27H43N3O.ClH/c1-4-13-28-14-16-29(17-15-28)26-6-5-24(30-19-21(2)31-22(3)20-30)18-25(26)23-7-9-27(10-8-23)11-12-27;/h5-6,18,21-23H,4,7-17,19-20H2,1-3H3;1H |
| InChIKey | FQGNZWGTDWDKLF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.12 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|