C30H51N3O — CID 69220121
(2S,6R)-4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]-2,6-dimethylmorpholine (PubChem CID 69220121) has the molecular formula C30H51N3O and a molecular weight of 469.76 g/mol. Its IUPAC name is (2S,6R)-4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 69220121 |
| Molecular Formula | C30H51N3O |
| Molecular Weight | 469.76 g/mol |
| Exact Mass | 469.40 |
| IUPAC Name | (2S,6R)-4-[4-(4-butylpiperazin-1-yl)-3-(4,4-diethylcyclohexyl)phenyl]-2,6-dimethylmorpholine |
| SMILES | CCCCN1CCN(c2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2C2CCC(CC)(CC)CC2)CC1 |
| InChI | InChI=1S/C30H51N3O/c1-6-9-16-31-17-19-32(20-18-31)29-11-10-27(33-22-24(4)34-25(5)23-33)21-28(29)26-12-14-30(7-2,8-3)15-13-26/h10-11,21,24-26H,6-9,12-20,22-23H2,1-5H3/t24-,25+ |
| InChIKey | DWVIZNHTCIIHSY-PLQXJYEYSA-N |
| XLogP | 6.69 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.76 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|