C30H52ClN3O — CID 68975190
1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]phenyl]piperazine;hydrochloride (PubChem CID 68975190) has the molecular formula C30H52ClN3O and a molecular weight of 506.22 g/mol. Its IUPAC name is 1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]phenyl]piperazine;hydrochloride.
| Compound Name | 1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 68975190 |
| Molecular Formula | C30H52ClN3O |
| Molecular Weight | 506.22 g/mol |
| Exact Mass | 505.38 |
| IUPAC Name | 1-butyl-4-[2-(4,4-diethylcyclohexyl)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]phenyl]piperazine;hydrochloride |
| SMILES | CCCCN1CCN(c2ccc(N3CCC[C@H]3COC)cc2C2CCC(CC)(CC)CC2)CC1.Cl |
| InChI | InChI=1S/C30H51N3O.ClH/c1-5-8-17-31-19-21-32(22-20-31)29-12-11-26(33-18-9-10-27(33)24-34-4)23-28(29)25-13-15-30(6-2,7-3)16-14-25;/h11-12,23,25,27H,5-10,13-22,24H2,1-4H3;1H/t27-;/m0./s1 |
| InChIKey | PEBHIHBXGPQPQL-YCBFMBTMSA-N |
| XLogP | 7.11 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.22 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|