C29H48ClN3O — CID 23142086
1-[4-(4-methoxypiperidin-1-yl)-2-spiro[2.5]octan-6-ylphenyl]-4-pentylpiperazine;hydrochloride (PubChem CID 23142086) has the molecular formula C29H48ClN3O and a molecular weight of 490.18 g/mol. Its IUPAC name is 1-[4-(4-methoxypiperidin-1-yl)-2-spiro[2.5]octan-6-ylphenyl]-4-pentylpiperazine;hydrochloride.
| Compound Name | 1-[4-(4-methoxypiperidin-1-yl)-2-spiro[2.5]octan-6-ylphenyl]-4-pentylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 23142086 |
| Molecular Formula | C29H48ClN3O |
| Molecular Weight | 490.18 g/mol |
| Exact Mass | 489.35 |
| IUPAC Name | 1-[4-(4-methoxypiperidin-1-yl)-2-spiro[2.5]octan-6-ylphenyl]-4-pentylpiperazine;hydrochloride |
| SMILES | CCCCCN1CCN(c2ccc(N3CCC(OC)CC3)cc2C2CCC3(CC2)CC3)CC1.Cl |
| InChI | InChI=1S/C29H47N3O.ClH/c1-3-4-5-16-30-19-21-32(22-20-30)28-7-6-25(31-17-10-26(33-2)11-18-31)23-27(28)24-8-12-29(13-9-24)14-15-29;/h6-7,23-24,26H,3-5,8-22H2,1-2H3;1H |
| InChIKey | ISGHKQYHOKAEKR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.18 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|