C31H51N3O — CID 58767861
1-(cyclopropylmethyl)-4-[2-(4,4-diethylcyclohexyl)-4-[4-(methoxymethyl)piperidin-1-yl]phenyl]piperazine (PubChem CID 58767861) has the molecular formula C31H51N3O and a molecular weight of 481.77 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[2-(4,4-diethylcyclohexyl)-4-[4-(methoxymethyl)piperidin-1-yl]phenyl]piperazine.
| Compound Name | 1-(cyclopropylmethyl)-4-[2-(4,4-diethylcyclohexyl)-4-[4-(methoxymethyl)piperidin-1-yl]phenyl]piperazine |
|---|---|
| PubChem CID | 58767861 |
| Molecular Formula | C31H51N3O |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.40 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[2-(4,4-diethylcyclohexyl)-4-[4-(methoxymethyl)piperidin-1-yl]phenyl]piperazine |
| SMILES | CCC1(CC)CCC(c2cc(N3CCC(COC)CC3)ccc2N2CCN(CC3CC3)CC2)CC1 |
| InChI | InChI=1S/C31H51N3O/c1-4-31(5-2)14-10-27(11-15-31)29-22-28(33-16-12-26(13-17-33)24-35-3)8-9-30(29)34-20-18-32(19-21-34)23-25-6-7-25/h8-9,22,25-27H,4-7,10-21,23-24H2,1-3H3 |
| InChIKey | OLTPKVTXAGDXAK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|