C27H44ClN3 — CID 23142955
1-(cyclopropylmethyl)-4-[2-(4,4-dimethylcyclohexyl)-4-piperidin-1-ylphenyl]piperazine;hydrochloride (PubChem CID 23142955) has the molecular formula C27H44ClN3 and a molecular weight of 446.12 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[2-(4,4-dimethylcyclohexyl)-4-piperidin-1-ylphenyl]piperazine;hydrochloride.
| Compound Name | 1-(cyclopropylmethyl)-4-[2-(4,4-dimethylcyclohexyl)-4-piperidin-1-ylphenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 23142955 |
| Molecular Formula | C27H44ClN3 |
| Molecular Weight | 446.12 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[2-(4,4-dimethylcyclohexyl)-4-piperidin-1-ylphenyl]piperazine;hydrochloride |
| SMILES | CC1(C)CCC(c2cc(N3CCCCC3)ccc2N2CCN(CC3CC3)CC2)CC1.Cl |
| InChI | InChI=1S/C27H43N3.ClH/c1-27(2)12-10-23(11-13-27)25-20-24(29-14-4-3-5-15-29)8-9-26(25)30-18-16-28(17-19-30)21-22-6-7-22;/h8-9,20,22-23H,3-7,10-19,21H2,1-2H3;1H |
| InChIKey | WYGCKQSNDVWUEN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.12 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|