C28H47N3 — CID 23141926
1-[2-(4-tert-butylcyclohexyl)-4-piperidin-1-ylphenyl]-4-propylpiperazine (PubChem CID 23141926) has the molecular formula C28H47N3 and a molecular weight of 425.71 g/mol. Its IUPAC name is 1-[2-(4-tert-butylcyclohexyl)-4-piperidin-1-ylphenyl]-4-propylpiperazine.
| Compound Name | 1-[2-(4-tert-butylcyclohexyl)-4-piperidin-1-ylphenyl]-4-propylpiperazine |
|---|---|
| PubChem CID | 23141926 |
| Molecular Formula | C28H47N3 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 425.38 |
| IUPAC Name | 1-[2-(4-tert-butylcyclohexyl)-4-piperidin-1-ylphenyl]-4-propylpiperazine |
| SMILES | CCCN1CCN(c2ccc(N3CCCCC3)cc2C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C28H47N3/c1-5-15-29-18-20-31(21-19-29)27-14-13-25(30-16-7-6-8-17-30)22-26(27)23-9-11-24(12-10-23)28(2,3)4/h13-14,22-24H,5-12,15-21H2,1-4H3 |
| InChIKey | PWXFEMCPIDNLBC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|