C29H47N3 — CID 23142680
1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)-4-piperidin-1-ylphenyl]piperazine (PubChem CID 23142680) has the molecular formula C29H47N3 and a molecular weight of 437.72 g/mol. Its IUPAC name is 1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)-4-piperidin-1-ylphenyl]piperazine.
| Compound Name | 1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)-4-piperidin-1-ylphenyl]piperazine |
|---|---|
| PubChem CID | 23142680 |
| Molecular Formula | C29H47N3 |
| Molecular Weight | 437.72 g/mol |
| Exact Mass | 437.38 |
| IUPAC Name | 1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)-4-piperidin-1-ylphenyl]piperazine |
| SMILES | CCCCN1CCN(c2ccc(N3CCCCC3)cc2C2=CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C29H47N3/c1-5-6-16-30-19-21-32(22-20-30)28-15-14-26(31-17-8-7-9-18-31)23-27(28)24-10-12-25(13-11-24)29(2,3)4/h10,14-15,23,25H,5-9,11-13,16-22H2,1-4H3 |
| InChIKey | SNDCTLXHMMLURT-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|