C28H48ClN3 — CID 23141815
1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-pyrrolidin-1-ylphenyl]piperazine;hydrochloride (PubChem CID 23141815) has the molecular formula C28H48ClN3 and a molecular weight of 462.17 g/mol. Its IUPAC name is 1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-pyrrolidin-1-ylphenyl]piperazine;hydrochloride.
| Compound Name | 1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-pyrrolidin-1-ylphenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 23141815 |
| Molecular Formula | C28H48ClN3 |
| Molecular Weight | 462.17 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | 1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-pyrrolidin-1-ylphenyl]piperazine;hydrochloride |
| SMILES | CCCCN1CCN(c2cc(N3CCCC3)ccc2C2CCC(C(C)(C)C)CC2)CC1.Cl |
| InChI | InChI=1S/C28H47N3.ClH/c1-5-6-15-29-18-20-31(21-19-29)27-22-25(30-16-7-8-17-30)13-14-26(27)23-9-11-24(12-10-23)28(2,3)4;/h13-14,22-24H,5-12,15-21H2,1-4H3;1H |
| InChIKey | VEJYZXMSVMBYEG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.17 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |