C28H48N2 — CID 23142503
1-butyl-4-[5-tert-butyl-2-(4-tert-butylcyclohexyl)phenyl]piperazine (PubChem CID 23142503) has the molecular formula C28H48N2 and a molecular weight of 412.71 g/mol. Its IUPAC name is 1-butyl-4-[5-tert-butyl-2-(4-tert-butylcyclohexyl)phenyl]piperazine.
| Compound Name | 1-butyl-4-[5-tert-butyl-2-(4-tert-butylcyclohexyl)phenyl]piperazine |
|---|---|
| PubChem CID | 23142503 |
| Molecular Formula | C28H48N2 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.38 |
| IUPAC Name | 1-butyl-4-[5-tert-butyl-2-(4-tert-butylcyclohexyl)phenyl]piperazine |
| SMILES | CCCCN1CCN(c2cc(C(C)(C)C)ccc2C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C28H48N2/c1-8-9-16-29-17-19-30(20-18-29)26-21-24(28(5,6)7)14-15-25(26)22-10-12-23(13-11-22)27(2,3)4/h14-15,21-23H,8-13,16-20H2,1-7H3 |
| InChIKey | UZRUZCRSGZDVJQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |